C10H16F2N2O — CID 129497714
1-[(3aS,7aR)-7,7-difluoro-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-aminoethanone (PubChem CID 129497714) has the molecular formula C10H16F2N2O and a molecular weight of 218.25 g/mol. Its IUPAC name is 1-[(3aS,7aR)-7,7-difluoro-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-aminoethanone.
| Compound Name | 1-[(3aS,7aR)-7,7-difluoro-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-aminoethanone |
|---|---|
| PubChem CID | 129497714 |
| Molecular Formula | C10H16F2N2O |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-[(3aS,7aR)-7,7-difluoro-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-aminoethanone |
| SMILES | NCC(=O)N1C[C@H]2CCCC(F)(F)[C@H]2C1 |
| InChI | InChI=1S/C10H16F2N2O/c11-10(12)3-1-2-7-5-14(6-8(7)10)9(15)4-13/h7-8H,1-6,13H2/t7-,8+/m1/s1 |
| InChIKey | NKTLVYOBJFTLAC-SFYZADRCSA-N |
| XLogP | 0.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |