C12H21NO4 — CID 129497980
4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid (PubChem CID 129497980) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 129497980 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid |
| SMILES | CCC[C@@H]1CN(C(=O)CCC(=O)O)CC[C@@H]1O |
| InChI | InChI=1S/C12H21NO4/c1-2-3-9-8-13(7-6-10(9)14)11(15)4-5-12(16)17/h9-10,14H,2-8H2,1H3,(H,16,17)/t9-,10+/m1/s1 |
| InChIKey | HKYPGRLMJDIQPM-ZJUUUORDSA-N |
| XLogP | 0.86 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |