4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid

C12H21NO4 — CID 129497980

IUPAC4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid
SMILESCCC[C@@H]1CN(C(=O)CCC(=O)O)CC[C@@H]1O
InChIInChI=1S/C12H21NO4/c1-2-3-9-8-13(7-6-10(9)14)11(15)4-5-12(16)17/h9-10,14H,2-8H2,1H3,(H,16,17)/t9-,10+/m1/s1
InChIKeyHKYPGRLMJDIQPM-ZJUUUORDSA-N
MW243.30 g/mol
LogP0.86
Rot. Bonds5

About 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid

4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid (PubChem CID 129497980) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid.

Molecular Properties

Compound Name4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid
PubChem CID129497980
Molecular FormulaC12H21NO4
Molecular Weight243.30 g/mol
Exact Mass243.15
IUPAC Name4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid
SMILESCCC[C@@H]1CN(C(=O)CCC(=O)O)CC[C@@H]1O
InChIInChI=1S/C12H21NO4/c1-2-3-9-8-13(7-6-10(9)14)11(15)4-5-12(16)17/h9-10,14H,2-8H2,1H3,(H,16,17)/t9-,10+/m1/s1
InChIKeyHKYPGRLMJDIQPM-ZJUUUORDSA-N
XLogP0.86
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500243.30
LogP ≤ 50.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid?
The IUPAC name of 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid (CID 129497980) is 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid.
What is the SMILES notation for 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid?
The canonical SMILES for 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid is CCC[C@@H]1CN(C(=O)CCC(=O)O)CC[C@@H]1O.
What is the InChIKey of 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid?
The InChIKey is HKYPGRLMJDIQPM-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H21NO4/c1-2-3-9-8-13(7-6-10(9)14)11(15)4-5-12(16)17/h9-10,14H,2-8H2,1H3,(H,16,17)/t9-,10+/m1/s1.
What are the key properties of 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid?
4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid has a molecular weight of 243.30 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3R,4S)-4-hydroxy-3-propylpiperidin-1-yl]-4-oxobutanoic acid is sourced from PubChem (CID 129497980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).