C13H16N2O3 — CID 129498052
(3S)-3-(4-hydroxyphenyl)-1-propan-2-ylpiperazine-2,5-dione (PubChem CID 129498052) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3S)-3-(4-hydroxyphenyl)-1-propan-2-ylpiperazine-2,5-dione.
| Compound Name | (3S)-3-(4-hydroxyphenyl)-1-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 129498052 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (3S)-3-(4-hydroxyphenyl)-1-propan-2-ylpiperazine-2,5-dione |
| SMILES | CC(C)N1CC(=O)N[C@@H](c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C13H16N2O3/c1-8(2)15-7-11(17)14-12(13(15)18)9-3-5-10(16)6-4-9/h3-6,8,12,16H,7H2,1-2H3,(H,14,17)/t12-/m0/s1 |
| InChIKey | CQFMUQAIBGGODV-LBPRGKRZSA-N |
| XLogP | 0.80 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |