C14H20N2 — CID 129498513
[(1R,5R)-3-benzyl-3-azabicyclo[3.2.0]heptan-1-yl]methanamine (PubChem CID 129498513) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is [(1R,5R)-3-benzyl-3-azabicyclo[3.2.0]heptan-1-yl]methanamine.
| Compound Name | [(1R,5R)-3-benzyl-3-azabicyclo[3.2.0]heptan-1-yl]methanamine |
|---|---|
| PubChem CID | 129498513 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | [(1R,5R)-3-benzyl-3-azabicyclo[3.2.0]heptan-1-yl]methanamine |
| SMILES | NC[C@@]12CC[C@H]1CN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C14H20N2/c15-10-14-7-6-13(14)9-16(11-14)8-12-4-2-1-3-5-12/h1-5,13H,6-11,15H2/t13-,14+/m0/s1 |
| InChIKey | LIIHLGGEVZMUBJ-UONOGXRCSA-N |
| XLogP | 1.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |