C13H6F4N2 — CID 12949943
2-phenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetonitrile (PubChem CID 12949943) has the molecular formula C13H6F4N2 and a molecular weight of 266.20 g/mol. Its IUPAC name is 2-phenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetonitrile.
| Compound Name | 2-phenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetonitrile |
|---|---|
| PubChem CID | 12949943 |
| Molecular Formula | C13H6F4N2 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-phenyl-2-(2,3,5,6-tetrafluoro-4-pyridinyl)acetonitrile |
| SMILES | N#CC(c1ccccc1)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C13H6F4N2/c14-10-9(11(15)13(17)19-12(10)16)8(6-18)7-4-2-1-3-5-7/h1-5,8H |
| InChIKey | WQHUSCYUWZXDNO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|