About 5-benzyl-3-phenyl-1H-1,2,4-triazole
5-benzyl-3-phenyl-1H-1,2,4-triazole (PubChem CID 12949989) has the molecular formula C15H13N3
and a molecular weight of 235.29 g/mol. Its IUPAC name is 5-benzyl-3-phenyl-1H-1,2,4-triazole.
Molecular Properties
| Compound Name | 5-benzyl-3-phenyl-1H-1,2,4-triazole |
| PubChem CID | 12949989 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-benzyl-3-phenyl-1H-1,2,4-triazole |
| SMILES | c1ccc(Cc2nc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C15H13N3/c1-3-7-12(8-4-1)11-14-16-15(18-17-14)13-9-5-2-6-10-13/h1-10H,11H2,(H,16,17,18) |
| InChIKey | VELJKZCOFOESAQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyl-3-phenyl-1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-3-phenyl-1H-1,2,4-triazole?
The IUPAC name of 5-benzyl-3-phenyl-1H-1,2,4-triazole (CID 12949989) is 5-benzyl-3-phenyl-1H-1,2,4-triazole.
What is the SMILES notation for 5-benzyl-3-phenyl-1H-1,2,4-triazole?
The canonical SMILES for 5-benzyl-3-phenyl-1H-1,2,4-triazole is c1ccc(Cc2nc(-c3ccccc3)n[nH]2)cc1.
What is the InChIKey of 5-benzyl-3-phenyl-1H-1,2,4-triazole?
The InChIKey is VELJKZCOFOESAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3/c1-3-7-12(8-4-1)11-14-16-15(18-17-14)13-9-5-2-6-10-13/h1-10H,11H2,(H,16,17,18).
What are the key properties of 5-benzyl-3-phenyl-1H-1,2,4-triazole?
5-benzyl-3-phenyl-1H-1,2,4-triazole has a molecular weight of 235.29 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3-phenyl-1H-1,2,4-triazole is sourced from PubChem (CID 12949989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).