C13H16O2 — CID 12950342
3,5,7-trimethyl-2-prop-2-enoxycyclohepta-2,4,6-trien-1-one (PubChem CID 12950342) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3,5,7-trimethyl-2-prop-2-enoxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 3,5,7-trimethyl-2-prop-2-enoxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 12950342 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 3,5,7-trimethyl-2-prop-2-enoxycyclohepta-2,4,6-trien-1-one |
| SMILES | C=CCOc1c(C)cc(C)cc(C)c1=O |
| InChI | InChI=1S/C13H16O2/c1-5-6-15-13-11(4)8-9(2)7-10(3)12(13)14/h5,7-8H,1,6H2,2-4H3 |
| InChIKey | XNGRMQNWEJNKLN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|