C11H15Cl — CID 12950376
(1R,2S,6R,7S)-4-(chloromethyl)tricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 12950376) has the molecular formula C11H15Cl and a molecular weight of 182.69 g/mol. Its IUPAC name is (1R,2S,6R,7S)-4-(chloromethyl)tricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1R,2S,6R,7S)-4-(chloromethyl)tricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 12950376 |
| Molecular Formula | C11H15Cl |
| Molecular Weight | 182.69 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1R,2S,6R,7S)-4-(chloromethyl)tricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | ClCC1C[C@@H]2[C@H](C1)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C11H15Cl/c12-6-7-3-10-8-1-2-9(5-8)11(10)4-7/h1-2,7-11H,3-6H2/t7?,8-,9+,10-,11+ |
| InChIKey | CYHCKKWYQUQOOH-RALPEPDASA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|