About 3-(propylamino)phenol
3-(propylamino)phenol (PubChem CID 12950423) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 3-(propylamino)phenol.
Molecular Properties
| Compound Name | 3-(propylamino)phenol |
| PubChem CID | 12950423 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 3-(propylamino)phenol |
| SMILES | CCCNc1cccc(O)c1 |
| InChI | InChI=1S/C9H13NO/c1-2-6-10-8-4-3-5-9(11)7-8/h3-5,7,10-11H,2,6H2,1H3 |
| InChIKey | MVULBFCSAWHERU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(propylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(propylamino)phenol?
The IUPAC name of 3-(propylamino)phenol (CID 12950423) is 3-(propylamino)phenol.
What is the SMILES notation for 3-(propylamino)phenol?
The canonical SMILES for 3-(propylamino)phenol is CCCNc1cccc(O)c1.
What is the InChIKey of 3-(propylamino)phenol?
The InChIKey is MVULBFCSAWHERU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-2-6-10-8-4-3-5-9(11)7-8/h3-5,7,10-11H,2,6H2,1H3.
What are the key properties of 3-(propylamino)phenol?
3-(propylamino)phenol has a molecular weight of 151.21 g/mol, XLogP of 2.21, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propylamino)phenol is sourced from PubChem (CID 12950423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).