About 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine
2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine (PubChem CID 12950984) has the molecular formula C22H25BrNP
and a molecular weight of 414.33 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine |
| PubChem CID | 12950984 |
| Molecular Formula | C22H25BrNP |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25BrNP/c1-24(2)18-19-25(23,20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17H,18-19H2,1-2H3 |
| InChIKey | PXPZMTYWEGGUHL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine?
The IUPAC name of 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine (CID 12950984) is 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine is CN(C)CCP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine?
The InChIKey is PXPZMTYWEGGUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25BrNP/c1-24(2)18-19-25(23,20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17H,18-19H2,1-2H3.
What are the key properties of 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine?
2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine has a molecular weight of 414.33 g/mol, XLogP of 4.39, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo(triphenyl)-λ5-phosphanyl]-N,N-dimethylethanamine is sourced from PubChem (CID 12950984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).