About ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate
ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate (PubChem CID 12951284) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate.
Analyze ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate?
The IUPAC name of ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate (CID 12951284) is ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate.
What is the SMILES notation for ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate?
The canonical SMILES for ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate is CCOC(=O)C1CC(=O)C2=C1CCC2.
What is the InChIKey of ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate?
The InChIKey is UHQXOAKLBLEGSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-14-11(13)9-6-10(12)8-5-3-4-7(8)9/h9H,2-6H2,1H3.
What are the key properties of ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate?
ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate has a molecular weight of 194.23 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxo-2,4,5,6-tetrahydro-1H-pentalene-1-carboxylate is sourced from PubChem (CID 12951284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).