About 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one
6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one (PubChem CID 12951289) has the molecular formula C10H12Cl2O
and a molecular weight of 219.11 g/mol. Its IUPAC name is 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one |
| PubChem CID | 12951289 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one |
| SMILES | CC1=CCCC(C)(/C(Cl)=C\Cl)C1=O |
| InChI | InChI=1S/C10H12Cl2O/c1-7-4-3-5-10(2,9(7)13)8(12)6-11/h4,6H,3,5H2,1-2H3/b8-6+ |
| InChIKey | XIFSAJNUJRZKMI-SOFGYWHQSA-N |
| XLogP | 3.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one?
The IUPAC name of 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one (CID 12951289) is 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one.
What is the SMILES notation for 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one?
The canonical SMILES for 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one is CC1=CCCC(C)(/C(Cl)=C\Cl)C1=O.
What is the InChIKey of 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one?
The InChIKey is XIFSAJNUJRZKMI-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H12Cl2O/c1-7-4-3-5-10(2,9(7)13)8(12)6-11/h4,6H,3,5H2,1-2H3/b8-6+.
What are the key properties of 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one?
6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one has a molecular weight of 219.11 g/mol, XLogP of 3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-1,2-dichloroethenyl]-2,6-dimethylcyclohex-2-en-1-one is sourced from PubChem (CID 12951289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).