About (E)-5,5-diethoxy-2,4-dimethylpent-2-enal
(E)-5,5-diethoxy-2,4-dimethylpent-2-enal (PubChem CID 12951378) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is (E)-5,5-diethoxy-2,4-dimethylpent-2-enal.
Molecular Properties
| Compound Name | (E)-5,5-diethoxy-2,4-dimethylpent-2-enal |
| PubChem CID | 12951378 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (E)-5,5-diethoxy-2,4-dimethylpent-2-enal |
| SMILES | CCOC(OCC)C(C)/C=C(\C)C=O |
| InChI | InChI=1S/C11H20O3/c1-5-13-11(14-6-2)10(4)7-9(3)8-12/h7-8,10-11H,5-6H2,1-4H3/b9-7+ |
| InChIKey | MDFMPTZZIUGJSE-VQHVLOKHSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5-diethoxy-2,4-dimethylpent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5-diethoxy-2,4-dimethylpent-2-enal?
The IUPAC name of (E)-5,5-diethoxy-2,4-dimethylpent-2-enal (CID 12951378) is (E)-5,5-diethoxy-2,4-dimethylpent-2-enal.
What is the SMILES notation for (E)-5,5-diethoxy-2,4-dimethylpent-2-enal?
The canonical SMILES for (E)-5,5-diethoxy-2,4-dimethylpent-2-enal is CCOC(OCC)C(C)/C=C(\C)C=O.
What is the InChIKey of (E)-5,5-diethoxy-2,4-dimethylpent-2-enal?
The InChIKey is MDFMPTZZIUGJSE-VQHVLOKHSA-N. The full InChI is InChI=1S/C11H20O3/c1-5-13-11(14-6-2)10(4)7-9(3)8-12/h7-8,10-11H,5-6H2,1-4H3/b9-7+.
What are the key properties of (E)-5,5-diethoxy-2,4-dimethylpent-2-enal?
(E)-5,5-diethoxy-2,4-dimethylpent-2-enal has a molecular weight of 200.28 g/mol, XLogP of 2.17, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5-diethoxy-2,4-dimethylpent-2-enal is sourced from PubChem (CID 12951378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).