C16H17NO — CID 12951842
2-phenyl-3,4,5,6-tetrahydro-2H-1,5-benzoxazocine (PubChem CID 12951842) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 2-phenyl-3,4,5,6-tetrahydro-2H-1,5-benzoxazocine.
| Compound Name | 2-phenyl-3,4,5,6-tetrahydro-2H-1,5-benzoxazocine |
|---|---|
| PubChem CID | 12951842 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 2-phenyl-3,4,5,6-tetrahydro-2H-1,5-benzoxazocine |
| SMILES | c1ccc(C2CCNCc3ccccc3O2)cc1 |
| InChI | InChI=1S/C16H17NO/c1-2-6-13(7-3-1)16-10-11-17-12-14-8-4-5-9-15(14)18-16/h1-9,16-17H,10-12H2 |
| InChIKey | GLLIZLOEESQFST-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |