About 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile
2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile (PubChem CID 12951939) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile |
| PubChem CID | 12951939 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile |
| SMILES | C=CCn1c(C)cc(CC#N)c1C |
| InChI | InChI=1S/C11H14N2/c1-4-7-13-9(2)8-11(5-6-12)10(13)3/h4,8H,1,5,7H2,2-3H3 |
| InChIKey | UYPMDCXGUGUQKT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile?
The IUPAC name of 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile (CID 12951939) is 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile.
What is the SMILES notation for 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile?
The canonical SMILES for 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile is C=CCn1c(C)cc(CC#N)c1C.
What is the InChIKey of 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile?
The InChIKey is UYPMDCXGUGUQKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-4-7-13-9(2)8-11(5-6-12)10(13)3/h4,8H,1,5,7H2,2-3H3.
What are the key properties of 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile?
2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile has a molecular weight of 174.25 g/mol, XLogP of 2.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)acetonitrile is sourced from PubChem (CID 12951939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).