C13H11BrO3 — CID 12952273
7-bromo-2-hydroxy-1,2,3,4-tetrahydroxanthen-9-one (PubChem CID 12952273) has the molecular formula C13H11BrO3 and a molecular weight of 295.13 g/mol. Its IUPAC name is 7-bromo-2-hydroxy-1,2,3,4-tetrahydroxanthen-9-one.
| Compound Name | 7-bromo-2-hydroxy-1,2,3,4-tetrahydroxanthen-9-one |
|---|---|
| PubChem CID | 12952273 |
| Molecular Formula | C13H11BrO3 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 7-bromo-2-hydroxy-1,2,3,4-tetrahydroxanthen-9-one |
| SMILES | O=c1c2c(oc3ccc(Br)cc13)CCC(O)C2 |
| InChI | InChI=1S/C13H11BrO3/c14-7-1-3-11-9(5-7)13(16)10-6-8(15)2-4-12(10)17-11/h1,3,5,8,15H,2,4,6H2 |
| InChIKey | DROUHTGBXFUQKP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |