C14H13BrO3 — CID 12952274
7-bromo-2-methoxy-1,2,3,4-tetrahydroxanthen-9-one (PubChem CID 12952274) has the molecular formula C14H13BrO3 and a molecular weight of 309.16 g/mol. Its IUPAC name is 7-bromo-2-methoxy-1,2,3,4-tetrahydroxanthen-9-one.
| Compound Name | 7-bromo-2-methoxy-1,2,3,4-tetrahydroxanthen-9-one |
|---|---|
| PubChem CID | 12952274 |
| Molecular Formula | C14H13BrO3 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 7-bromo-2-methoxy-1,2,3,4-tetrahydroxanthen-9-one |
| SMILES | COC1CCc2oc3ccc(Br)cc3c(=O)c2C1 |
| InChI | InChI=1S/C14H13BrO3/c1-17-9-3-5-13-11(7-9)14(16)10-6-8(15)2-4-12(10)18-13/h2,4,6,9H,3,5,7H2,1H3 |
| InChIKey | LHJLAOLAINQYMV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |