C22H28N2O — CID 12952312
3-(4-benzylpiperazin-1-yl)-2-methyl-1-(4-methylphenyl)propan-1-one (PubChem CID 12952312) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-2-methyl-1-(4-methylphenyl)propan-1-one.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-2-methyl-1-(4-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 12952312 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-2-methyl-1-(4-methylphenyl)propan-1-one |
| SMILES | Cc1ccc(C(=O)C(C)CN2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H28N2O/c1-18-8-10-21(11-9-18)22(25)19(2)16-23-12-14-24(15-13-23)17-20-6-4-3-5-7-20/h3-11,19H,12-17H2,1-2H3 |
| InChIKey | SOHKDGHEDOCROO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |