C19H22ClNO — CID 12952373
1-(6-chloronaphthalen-2-yl)-2-methyl-3-piperidin-1-ylpropan-1-one (PubChem CID 12952373) has the molecular formula C19H22ClNO and a molecular weight of 315.84 g/mol. Its IUPAC name is 1-(6-chloronaphthalen-2-yl)-2-methyl-3-piperidin-1-ylpropan-1-one.
| Compound Name | 1-(6-chloronaphthalen-2-yl)-2-methyl-3-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 12952373 |
| Molecular Formula | C19H22ClNO |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(6-chloronaphthalen-2-yl)-2-methyl-3-piperidin-1-ylpropan-1-one |
| SMILES | CC(CN1CCCCC1)C(=O)c1ccc2cc(Cl)ccc2c1 |
| InChI | InChI=1S/C19H22ClNO/c1-14(13-21-9-3-2-4-10-21)19(22)17-6-5-16-12-18(20)8-7-15(16)11-17/h5-8,11-12,14H,2-4,9-10,13H2,1H3 |
| InChIKey | SXGPVLLJPNUVPF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |