C9H15BrO3 — CID 12952574
(1R,2S,3S,5R)-2-bromo-6,6-dimethoxybicyclo[3.2.0]heptan-3-ol (PubChem CID 12952574) has the molecular formula C9H15BrO3 and a molecular weight of 251.12 g/mol. Its IUPAC name is (1R,2S,3S,5R)-2-bromo-6,6-dimethoxybicyclo[3.2.0]heptan-3-ol.
| Compound Name | (1R,2S,3S,5R)-2-bromo-6,6-dimethoxybicyclo[3.2.0]heptan-3-ol |
|---|---|
| PubChem CID | 12952574 |
| Molecular Formula | C9H15BrO3 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | (1R,2S,3S,5R)-2-bromo-6,6-dimethoxybicyclo[3.2.0]heptan-3-ol |
| SMILES | COC1(OC)C[C@H]2[C@H](Br)[C@@H](O)C[C@H]21 |
| InChI | InChI=1S/C9H15BrO3/c1-12-9(13-2)4-5-6(9)3-7(11)8(5)10/h5-8,11H,3-4H2,1-2H3/t5-,6-,7+,8+/m1/s1 |
| InChIKey | RLURUCSTUIJZRI-NGJRWZKOSA-N |
| XLogP | 1.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|