About N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine
N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine (PubChem CID 1295310) has the molecular formula C13H16N2O4S3
and a molecular weight of 360.48 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine |
| PubChem CID | 1295310 |
| Molecular Formula | C13H16N2O4S3 |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine |
| SMILES | Cc1ccc(S(=O)(=O)c2nc(S(C)(=O)=O)sc2N(C)C)cc1 |
| InChI | InChI=1S/C13H16N2O4S3/c1-9-5-7-10(8-6-9)22(18,19)11-12(15(2)3)20-13(14-11)21(4,16)17/h5-8H,1-4H3 |
| InChIKey | AYNZZBGHKIJCDG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine?
The IUPAC name of N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine (CID 1295310) is N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine.
What is the SMILES notation for N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine?
The canonical SMILES for N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine is Cc1ccc(S(=O)(=O)c2nc(S(C)(=O)=O)sc2N(C)C)cc1.
What is the InChIKey of N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine?
The InChIKey is AYNZZBGHKIJCDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O4S3/c1-9-5-7-10(8-6-9)22(18,19)11-12(15(2)3)20-13(14-11)21(4,16)17/h5-8H,1-4H3.
What are the key properties of N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine?
N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine has a molecular weight of 360.48 g/mol, XLogP of 1.75, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-4-(4-methylphenyl)sulfonyl-2-methylsulfonyl-1,3-thiazol-5-amine is sourced from PubChem (CID 1295310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).