About 2-cyclopropyl-1,3-dihydroisoindole
2-cyclopropyl-1,3-dihydroisoindole (PubChem CID 12953703) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-cyclopropyl-1,3-dihydroisoindole |
| PubChem CID | 12953703 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-cyclopropyl-1,3-dihydroisoindole |
| SMILES | c1ccc2c(c1)CN(C1CC1)C2 |
| InChI | InChI=1S/C11H13N/c1-2-4-10-8-12(11-5-6-11)7-9(10)3-1/h1-4,11H,5-8H2 |
| InChIKey | XMZMBSSVHCEAEG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-1,3-dihydroisoindole?
The IUPAC name of 2-cyclopropyl-1,3-dihydroisoindole (CID 12953703) is 2-cyclopropyl-1,3-dihydroisoindole.
What is the SMILES notation for 2-cyclopropyl-1,3-dihydroisoindole?
The canonical SMILES for 2-cyclopropyl-1,3-dihydroisoindole is c1ccc2c(c1)CN(C1CC1)C2.
What is the InChIKey of 2-cyclopropyl-1,3-dihydroisoindole?
The InChIKey is XMZMBSSVHCEAEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-2-4-10-8-12(11-5-6-11)7-9(10)3-1/h1-4,11H,5-8H2.
What are the key properties of 2-cyclopropyl-1,3-dihydroisoindole?
2-cyclopropyl-1,3-dihydroisoindole has a molecular weight of 159.23 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-1,3-dihydroisoindole is sourced from PubChem (CID 12953703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).