C23H32O5 — CID 12953871
[8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] cyclopropanecarboxylate (PubChem CID 12953871) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is [8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] cyclopropanecarboxylate.
| Compound Name | [8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 12953871 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [8-[2-(4-hydroxy-6-oxooxan-2-yl)ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] cyclopropanecarboxylate |
| SMILES | CC1C=C2C=CC(C)C(CCC3CC(O)CC(=O)O3)C2C(OC(=O)C2CC2)C1 |
| InChI | InChI=1S/C23H32O5/c1-13-9-16-4-3-14(2)19(8-7-18-11-17(24)12-21(25)27-18)22(16)20(10-13)28-23(26)15-5-6-15/h3-4,9,13-15,17-20,22,24H,5-8,10-12H2,1-2H3 |
| InChIKey | DHTCRYGDMZYDPH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |