C12H5F7O — CID 12954352
2-ethoxy-1,3,4,5,6,7,8-heptafluoronaphthalene (PubChem CID 12954352) has the molecular formula C12H5F7O and a molecular weight of 298.16 g/mol. Its IUPAC name is 2-ethoxy-1,3,4,5,6,7,8-heptafluoronaphthalene.
| Compound Name | 2-ethoxy-1,3,4,5,6,7,8-heptafluoronaphthalene |
|---|---|
| PubChem CID | 12954352 |
| Molecular Formula | C12H5F7O |
| Molecular Weight | 298.16 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-ethoxy-1,3,4,5,6,7,8-heptafluoronaphthalene |
| SMILES | CCOc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F |
| InChI | InChI=1S/C12H5F7O/c1-2-20-12-8(16)4-3(7(15)11(12)19)5(13)9(17)10(18)6(4)14/h2H2,1H3 |
| InChIKey | BOYVYDOXNFCYGF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.16 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|