C30F25O5P — CID 12954707
pentakis(2,3,4,5,6-pentafluorophenoxy)-lambda5-phosphane (PubChem CID 12954707) has the molecular formula C30F25O5P and a molecular weight of 946.25 g/mol. Its IUPAC name is pentakis(2,3,4,5,6-pentafluorophenoxy)-lambda5-phosphane.
| Compound Name | pentakis(2,3,4,5,6-pentafluorophenoxy)-lambda5-phosphane |
|---|---|
| PubChem CID | 12954707 |
| Molecular Formula | C30F25O5P |
| Molecular Weight | 946.25 g/mol |
| Exact Mass | 945.91 |
| IUPAC Name | pentakis(2,3,4,5,6-pentafluorophenoxy)-lambda5-phosphane |
| SMILES | Fc1c(F)c(F)c(OP(Oc2c(F)c(F)c(F)c(F)c2F)(Oc2c(F)c(F)c(F)c(F)c2F)(Oc2c(F)c(F)c(F)c(F)c2F)Oc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30F25O5P/c31-1-6(36)16(46)26(17(47)7(1)37)56-61(57-27-18(48)8(38)2(32)9(39)19(27)49,58-28-20(50)10(40)3(33)11(41)21(28)51,59-29-22(52)12(42)4(34)13(43)23(29)53)60-30-24(54)14(44)5(35)15(45)25(30)55 |
| InChIKey | SJZAIXYVICJKDL-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.25 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|