C14H4F10O — CID 12954709
1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methoxymethyl]benzene (PubChem CID 12954709) has the molecular formula C14H4F10O and a molecular weight of 378.17 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methoxymethyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methoxymethyl]benzene |
|---|---|
| PubChem CID | 12954709 |
| Molecular Formula | C14H4F10O |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(2,3,4,5,6-pentafluorophenyl)methoxymethyl]benzene |
| SMILES | Fc1c(F)c(F)c(COCc2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H4F10O/c15-5-3(6(16)10(20)13(23)9(5)19)1-25-2-4-7(17)11(21)14(24)12(22)8(4)18/h1-2H2 |
| InChIKey | JTIUZNMNFPZOKN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|