About 4-methyl-2-propyl-1,4-benzothiazin-3-one
4-methyl-2-propyl-1,4-benzothiazin-3-one (PubChem CID 12954907) has the molecular formula C12H15NOS
and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-methyl-2-propyl-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 4-methyl-2-propyl-1,4-benzothiazin-3-one |
| PubChem CID | 12954907 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-methyl-2-propyl-1,4-benzothiazin-3-one |
| SMILES | CCCC1Sc2ccccc2N(C)C1=O |
| InChI | InChI=1S/C12H15NOS/c1-3-6-11-12(14)13(2)9-7-4-5-8-10(9)15-11/h4-5,7-8,11H,3,6H2,1-2H3 |
| InChIKey | BRTQPZCUDNZLHO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-2-propyl-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-propyl-1,4-benzothiazin-3-one?
The IUPAC name of 4-methyl-2-propyl-1,4-benzothiazin-3-one (CID 12954907) is 4-methyl-2-propyl-1,4-benzothiazin-3-one.
What is the SMILES notation for 4-methyl-2-propyl-1,4-benzothiazin-3-one?
The canonical SMILES for 4-methyl-2-propyl-1,4-benzothiazin-3-one is CCCC1Sc2ccccc2N(C)C1=O.
What is the InChIKey of 4-methyl-2-propyl-1,4-benzothiazin-3-one?
The InChIKey is BRTQPZCUDNZLHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NOS/c1-3-6-11-12(14)13(2)9-7-4-5-8-10(9)15-11/h4-5,7-8,11H,3,6H2,1-2H3.
What are the key properties of 4-methyl-2-propyl-1,4-benzothiazin-3-one?
4-methyl-2-propyl-1,4-benzothiazin-3-one has a molecular weight of 221.33 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-propyl-1,4-benzothiazin-3-one is sourced from PubChem (CID 12954907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).