About 3-ethenyl-2,3-dihydro-1H-indole
3-ethenyl-2,3-dihydro-1H-indole (PubChem CID 12955131) has the molecular formula C10H11N
and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-ethenyl-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 3-ethenyl-2,3-dihydro-1H-indole |
| PubChem CID | 12955131 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-ethenyl-2,3-dihydro-1H-indole |
| SMILES | C=CC1CNc2ccccc21 |
| InChI | InChI=1S/C10H11N/c1-2-8-7-11-10-6-4-3-5-9(8)10/h2-6,8,11H,1,7H2 |
| InChIKey | HJAJENHOSRXMNY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2,3-dihydro-1H-indole?
The IUPAC name of 3-ethenyl-2,3-dihydro-1H-indole (CID 12955131) is 3-ethenyl-2,3-dihydro-1H-indole.
What is the SMILES notation for 3-ethenyl-2,3-dihydro-1H-indole?
The canonical SMILES for 3-ethenyl-2,3-dihydro-1H-indole is C=CC1CNc2ccccc21.
What is the InChIKey of 3-ethenyl-2,3-dihydro-1H-indole?
The InChIKey is HJAJENHOSRXMNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N/c1-2-8-7-11-10-6-4-3-5-9(8)10/h2-6,8,11H,1,7H2.
What are the key properties of 3-ethenyl-2,3-dihydro-1H-indole?
3-ethenyl-2,3-dihydro-1H-indole has a molecular weight of 145.20 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2,3-dihydro-1H-indole is sourced from PubChem (CID 12955131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).