About 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one
5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one (PubChem CID 12955654) has the molecular formula C13H18N2O2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one |
| PubChem CID | 12955654 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one |
| SMILES | CC1(C)NC(=O)N(CCc2ccccc2)C1O |
| InChI | InChI=1S/C13H18N2O2/c1-13(2)11(16)15(12(17)14-13)9-8-10-6-4-3-5-7-10/h3-7,11,16H,8-9H2,1-2H3,(H,14,17) |
| InChIKey | HMBAGIWVHSMZGN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one?
The IUPAC name of 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one (CID 12955654) is 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one.
What is the SMILES notation for 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one?
The canonical SMILES for 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one is CC1(C)NC(=O)N(CCc2ccccc2)C1O.
What is the InChIKey of 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one?
The InChIKey is HMBAGIWVHSMZGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2/c1-13(2)11(16)15(12(17)14-13)9-8-10-6-4-3-5-7-10/h3-7,11,16H,8-9H2,1-2H3,(H,14,17).
What are the key properties of 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one?
5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one has a molecular weight of 234.30 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-4,4-dimethyl-1-(2-phenylethyl)imidazolidin-2-one is sourced from PubChem (CID 12955654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).