About 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol
7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol (PubChem CID 12955661) has the molecular formula C10H8Br2NO+
and a molecular weight of 317.99 g/mol. Its IUPAC name is 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol.
Molecular Properties
| Compound Name | 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol |
| PubChem CID | 12955661 |
| Molecular Formula | C10H8Br2NO+ |
| Molecular Weight | 317.99 g/mol |
| Exact Mass | 315.90 |
| IUPAC Name | 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol |
| SMILES | OC1=C(Br)C=C(Br)C[n+]2ccccc21 |
| InChI | InChI=1S/C10H7Br2NO/c11-7-5-8(12)10(14)9-3-1-2-4-13(9)6-7/h1-5H,6H2/p+1 |
| InChIKey | LBNSWQDVPMHVAC-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.99 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol?
The IUPAC name of 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol (CID 12955661) is 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol.
What is the SMILES notation for 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol?
The canonical SMILES for 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol is OC1=C(Br)C=C(Br)C[n+]2ccccc21.
What is the InChIKey of 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol?
The InChIKey is LBNSWQDVPMHVAC-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H7Br2NO/c11-7-5-8(12)10(14)9-3-1-2-4-13(9)6-7/h1-5H,6H2/p+1.
What are the key properties of 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol?
7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol has a molecular weight of 317.99 g/mol, XLogP of 2.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-dibromo-6H-pyrido[1,2-a]azepin-5-ium-10-ol is sourced from PubChem (CID 12955661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).