About (1S)-2,2-difluoro-1-phenylethanol
(1S)-2,2-difluoro-1-phenylethanol (PubChem CID 12955761) has the molecular formula C8H8F2O
and a molecular weight of 158.15 g/mol. Its IUPAC name is (1S)-2,2-difluoro-1-phenylethanol.
Molecular Properties
| Compound Name | (1S)-2,2-difluoro-1-phenylethanol |
| PubChem CID | 12955761 |
| Molecular Formula | C8H8F2O |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | (1S)-2,2-difluoro-1-phenylethanol |
| SMILES | O[C@@H](c1ccccc1)C(F)F |
| InChI | InChI=1S/C8H8F2O/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,7-8,11H/t7-/m0/s1 |
| InChIKey | XOYZGEQHDLLDHZ-ZETCQYMHSA-N |
| XLogP | 1.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-2,2-difluoro-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,2-difluoro-1-phenylethanol?
The IUPAC name of (1S)-2,2-difluoro-1-phenylethanol (CID 12955761) is (1S)-2,2-difluoro-1-phenylethanol.
What is the SMILES notation for (1S)-2,2-difluoro-1-phenylethanol?
The canonical SMILES for (1S)-2,2-difluoro-1-phenylethanol is O[C@@H](c1ccccc1)C(F)F.
What is the InChIKey of (1S)-2,2-difluoro-1-phenylethanol?
The InChIKey is XOYZGEQHDLLDHZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H8F2O/c9-8(10)7(11)6-4-2-1-3-5-6/h1-5,7-8,11H/t7-/m0/s1.
What are the key properties of (1S)-2,2-difluoro-1-phenylethanol?
(1S)-2,2-difluoro-1-phenylethanol has a molecular weight of 158.15 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,2-difluoro-1-phenylethanol is sourced from PubChem (CID 12955761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).