C5H4F6N2O2 — CID 12955812
2,2,2-trifluoro-N'-methyl-N'-(2,2,2-trifluoroacetyl)acetohydrazide (PubChem CID 12955812) has the molecular formula C5H4F6N2O2 and a molecular weight of 238.09 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-methyl-N'-(2,2,2-trifluoroacetyl)acetohydrazide.
| Compound Name | 2,2,2-trifluoro-N'-methyl-N'-(2,2,2-trifluoroacetyl)acetohydrazide |
|---|---|
| PubChem CID | 12955812 |
| Molecular Formula | C5H4F6N2O2 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 2,2,2-trifluoro-N'-methyl-N'-(2,2,2-trifluoroacetyl)acetohydrazide |
| SMILES | CN(NC(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C5H4F6N2O2/c1-13(3(15)5(9,10)11)12-2(14)4(6,7)8/h1H3,(H,12,14) |
| InChIKey | HFJMBJBZLRKLFX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|