About methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate
methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate (PubChem CID 12955916) has the molecular formula C19H17FN2O3
and a molecular weight of 340.35 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate |
| PubChem CID | 12955916 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate |
| SMILES | COC(=O)c1c(C)c(C)cc2c(=O)n(-c3ccc(F)cc3)c(C)nc12 |
| InChI | InChI=1S/C19H17FN2O3/c1-10-9-15-17(16(11(10)2)19(24)25-4)21-12(3)22(18(15)23)14-7-5-13(20)6-8-14/h5-9H,1-4H3 |
| InChIKey | KWVZLRJCFDJZCX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate?
The IUPAC name of methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate (CID 12955916) is methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate.
What is the SMILES notation for methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate?
The canonical SMILES for methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate is COC(=O)c1c(C)c(C)cc2c(=O)n(-c3ccc(F)cc3)c(C)nc12.
What is the InChIKey of methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate?
The InChIKey is KWVZLRJCFDJZCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O3/c1-10-9-15-17(16(11(10)2)19(24)25-4)21-12(3)22(18(15)23)14-7-5-13(20)6-8-14/h5-9H,1-4H3.
What are the key properties of methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate?
methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate has a molecular weight of 340.35 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4-fluorophenyl)-2,6,7-trimethyl-4-oxoquinazoline-8-carboxylate is sourced from PubChem (CID 12955916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).