C17H16O4 — CID 12956141
dimethyl (1E,2E,4E,6E,8Z,10Z)-bicyclo[5.5.1]trideca-1(12),2,4,6,8,10-hexaene-3,4-dicarboxylate (PubChem CID 12956141) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is dimethyl (1E,2E,4E,6E,8Z,10Z)-bicyclo[5.5.1]trideca-1(12),2,4,6,8,10-hexaene-3,4-dicarboxylate.
| Compound Name | dimethyl (1E,2E,4E,6E,8Z,10Z)-bicyclo[5.5.1]trideca-1(12),2,4,6,8,10-hexaene-3,4-dicarboxylate |
|---|---|
| PubChem CID | 12956141 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | dimethyl (1E,2E,4E,6E,8Z,10Z)-bicyclo[5.5.1]trideca-1(12),2,4,6,8,10-hexaene-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C/C=C2/C=C\C=C/C=C(\C=C/1C(=O)OC)C2 |
| InChI | InChI=1S/C17H16O4/c1-20-16(18)14-9-8-12-6-4-3-5-7-13(10-12)11-15(14)17(19)21-2/h3-9,11H,10H2,1-2H3/b4-3-,5-3-,6-4-,7-5-,9-8-,12-6-,12-8-,13-7+,13-11-,14-9+,15-11+,15-14- |
| InChIKey | BMHSRVJTXIMSSN-NJSBNHTOSA-N |
| XLogP | 2.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |