C9H20OSi2 — CID 12956517
1,3-bis(trimethylsilyl)prop-2-yn-1-ol (PubChem CID 12956517) has the molecular formula C9H20OSi2 and a molecular weight of 200.43 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyl)prop-2-yn-1-ol.
| Compound Name | 1,3-bis(trimethylsilyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 12956517 |
| Molecular Formula | C9H20OSi2 |
| Molecular Weight | 200.43 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1,3-bis(trimethylsilyl)prop-2-yn-1-ol |
| SMILES | C[Si](C)(C)C#CC(O)[Si](C)(C)C |
| InChI | InChI=1S/C9H20OSi2/c1-11(2,3)8-7-9(10)12(4,5)6/h9-10H,1-6H3 |
| InChIKey | QBURMWLMRPARFA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|