About 2-phenyl-4H-thiochromene
2-phenyl-4H-thiochromene (PubChem CID 12957315) has the molecular formula C15H12S
and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-phenyl-4H-thiochromene.
Molecular Properties
| Compound Name | 2-phenyl-4H-thiochromene |
| PubChem CID | 12957315 |
| Molecular Formula | C15H12S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-phenyl-4H-thiochromene |
| SMILES | C1=C(c2ccccc2)Sc2ccccc2C1 |
| InChI | InChI=1S/C15H12S/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-9,11H,10H2 |
| InChIKey | YQXGMDHETWBHLV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-4H-thiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-4H-thiochromene?
The IUPAC name of 2-phenyl-4H-thiochromene (CID 12957315) is 2-phenyl-4H-thiochromene.
What is the SMILES notation for 2-phenyl-4H-thiochromene?
The canonical SMILES for 2-phenyl-4H-thiochromene is C1=C(c2ccccc2)Sc2ccccc2C1.
What is the InChIKey of 2-phenyl-4H-thiochromene?
The InChIKey is YQXGMDHETWBHLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12S/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15/h1-9,11H,10H2.
What are the key properties of 2-phenyl-4H-thiochromene?
2-phenyl-4H-thiochromene has a molecular weight of 224.33 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-4H-thiochromene is sourced from PubChem (CID 12957315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).