About CID 12957621
CID 12957621 (PubChem CID 12957621) has the molecular formula C9H15LiN2
and a molecular weight of 158.17 g/mol.
Molecular Properties
| Compound Name | CID 12957621 |
| PubChem CID | 12957621 |
| Molecular Formula | C9H15LiN2 |
| Molecular Weight | 158.17 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | — |
| SMILES | [CH-]1CCCCN2CCCN=C12.[Li+] |
| InChI | InChI=1S/C9H15N2.Li/c1-2-5-9-10-6-4-8-11(9)7-3-1;/h5H,1-4,6-8H2;/q-1;+1 |
| InChIKey | QZSHOGWHDVXVNV-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.17 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 12957621 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12957621?
The IUPAC name of CID 12957621 (CID 12957621) is not available.
What is the SMILES notation for CID 12957621?
The canonical SMILES for CID 12957621 is [CH-]1CCCCN2CCCN=C12.[Li+].
What is the InChIKey of CID 12957621?
The InChIKey is QZSHOGWHDVXVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N2.Li/c1-2-5-9-10-6-4-8-11(9)7-3-1;/h5H,1-4,6-8H2;/q-1;+1.
What are the key properties of CID 12957621?
CID 12957621 has a molecular weight of 158.17 g/mol, XLogP of -1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12957621 is sourced from PubChem (CID 12957621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).