About 5-methoxy-1-methyl-1,2,4-triazol-3-amine
5-methoxy-1-methyl-1,2,4-triazol-3-amine (PubChem CID 12957664) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is 5-methoxy-1-methyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-methoxy-1-methyl-1,2,4-triazol-3-amine |
| PubChem CID | 12957664 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 5-methoxy-1-methyl-1,2,4-triazol-3-amine |
| SMILES | COc1nc(N)nn1C |
| InChI | InChI=1S/C4H8N4O/c1-8-4(9-2)6-3(5)7-8/h1-2H3,(H2,5,7) |
| InChIKey | CRSLWSVXSWZHOO-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methoxy-1-methyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1-methyl-1,2,4-triazol-3-amine?
The IUPAC name of 5-methoxy-1-methyl-1,2,4-triazol-3-amine (CID 12957664) is 5-methoxy-1-methyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-methoxy-1-methyl-1,2,4-triazol-3-amine?
The canonical SMILES for 5-methoxy-1-methyl-1,2,4-triazol-3-amine is COc1nc(N)nn1C.
What is the InChIKey of 5-methoxy-1-methyl-1,2,4-triazol-3-amine?
The InChIKey is CRSLWSVXSWZHOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O/c1-8-4(9-2)6-3(5)7-8/h1-2H3,(H2,5,7).
What are the key properties of 5-methoxy-1-methyl-1,2,4-triazol-3-amine?
5-methoxy-1-methyl-1,2,4-triazol-3-amine has a molecular weight of 128.13 g/mol, XLogP of -0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1-methyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 12957664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).