C5H11N5 — CID 12957667
5-N,5-N,1-trimethyl-1,2,4-triazole-3,5-diamine (PubChem CID 12957667) has the molecular formula C5H11N5 and a molecular weight of 141.18 g/mol. Its IUPAC name is 5-N,5-N,1-trimethyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 5-N,5-N,1-trimethyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 12957667 |
| Molecular Formula | C5H11N5 |
| Molecular Weight | 141.18 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 5-N,5-N,1-trimethyl-1,2,4-triazole-3,5-diamine |
| SMILES | CN(C)c1nc(N)nn1C |
| InChI | InChI=1S/C5H11N5/c1-9(2)5-7-4(6)8-10(5)3/h1-3H3,(H2,6,8) |
| InChIKey | YPVUBEWWGNRQAM-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.18 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |