C14H30Si5 — CID 12957917
1,1,2,2,3,3,6,6,7,7-decamethyl-1,2,3,6,7-pentasilacyclonona-4,8-diyne (PubChem CID 12957917) has the molecular formula C14H30Si5 and a molecular weight of 338.82 g/mol. Its IUPAC name is 1,1,2,2,3,3,6,6,7,7-decamethyl-1,2,3,6,7-pentasilacyclonona-4,8-diyne.
| Compound Name | 1,1,2,2,3,3,6,6,7,7-decamethyl-1,2,3,6,7-pentasilacyclonona-4,8-diyne |
|---|---|
| PubChem CID | 12957917 |
| Molecular Formula | C14H30Si5 |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1,1,2,2,3,3,6,6,7,7-decamethyl-1,2,3,6,7-pentasilacyclonona-4,8-diyne |
| SMILES | C[Si]1(C)C#C[Si](C)(C)[Si](C)(C)[Si](C)(C)C#C[Si]1(C)C |
| InChI | InChI=1S/C14H30Si5/c1-15(2)11-13-17(5,6)19(9,10)18(7,8)14-12-16(15,3)4/h1-10H3 |
| InChIKey | HMMUEBRZMCWOSO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|