C12H24Si4 — CID 12957918
1,1,2,2,5,5,6,6-octamethyl-1,2,5,6-tetrasilacycloocta-3,7-diyne (PubChem CID 12957918) has the molecular formula C12H24Si4 and a molecular weight of 280.67 g/mol. Its IUPAC name is 1,1,2,2,5,5,6,6-octamethyl-1,2,5,6-tetrasilacycloocta-3,7-diyne.
| Compound Name | 1,1,2,2,5,5,6,6-octamethyl-1,2,5,6-tetrasilacycloocta-3,7-diyne |
|---|---|
| PubChem CID | 12957918 |
| Molecular Formula | C12H24Si4 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1,1,2,2,5,5,6,6-octamethyl-1,2,5,6-tetrasilacycloocta-3,7-diyne |
| SMILES | C[Si]1(C)C#C[Si](C)(C)[Si](C)(C)C#C[Si]1(C)C |
| InChI | InChI=1S/C12H24Si4/c1-13(2)9-10-15(5,6)16(7,8)12-11-14(13,3)4/h1-8H3 |
| InChIKey | ZZOIGABMGLBWRE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|