C10H18Si3 — CID 12957919
1,1,2,2,5,5-hexamethyl-1,2,5-trisilacyclohepta-3,6-diyne (PubChem CID 12957919) has the molecular formula C10H18Si3 and a molecular weight of 222.51 g/mol. Its IUPAC name is 1,1,2,2,5,5-hexamethyl-1,2,5-trisilacyclohepta-3,6-diyne.
| Compound Name | 1,1,2,2,5,5-hexamethyl-1,2,5-trisilacyclohepta-3,6-diyne |
|---|---|
| PubChem CID | 12957919 |
| Molecular Formula | C10H18Si3 |
| Molecular Weight | 222.51 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1,1,2,2,5,5-hexamethyl-1,2,5-trisilacyclohepta-3,6-diyne |
| SMILES | C[Si]1(C)C#C[Si](C)(C)[Si](C)(C)C#C1 |
| InChI | InChI=1S/C10H18Si3/c1-11(2)7-9-12(3,4)13(5,6)10-8-11/h1-6H3 |
| InChIKey | LVTOUVXBEGAQPS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|