About 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one
8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one (PubChem CID 12958081) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one.
Analyze 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one?
The IUPAC name of 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one (CID 12958081) is 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one.
What is the SMILES notation for 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one?
The canonical SMILES for 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one is COC1CCCC2CCC(=O)C=C21.
What is the InChIKey of 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one?
The InChIKey is GCBKBUAQSUOEIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11/h7-8,11H,2-6H2,1H3.
What are the key properties of 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one?
8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one has a molecular weight of 180.25 g/mol, XLogP of 2.09, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-one is sourced from PubChem (CID 12958081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).