C14H20O3S — CID 12958388
(1R)-2-(benzenesulfonyl)-1-cyclohexylethanol (PubChem CID 12958388) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is (1R)-2-(benzenesulfonyl)-1-cyclohexylethanol.
| Compound Name | (1R)-2-(benzenesulfonyl)-1-cyclohexylethanol |
|---|---|
| PubChem CID | 12958388 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1R)-2-(benzenesulfonyl)-1-cyclohexylethanol |
| SMILES | O=S(=O)(C[C@H](O)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C14H20O3S/c15-14(12-7-3-1-4-8-12)11-18(16,17)13-9-5-2-6-10-13/h2,5-6,9-10,12,14-15H,1,3-4,7-8,11H2/t14-/m0/s1 |
| InChIKey | LASHFTVHRKRTKQ-AWEZNQCLSA-N |
| XLogP | 2.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |