About 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal
3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal (PubChem CID 12958419) has the molecular formula C11H13IO3
and a molecular weight of 320.13 g/mol. Its IUPAC name is 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal.
Molecular Properties
| Compound Name | 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal |
| PubChem CID | 12958419 |
| Molecular Formula | C11H13IO3 |
| Molecular Weight | 320.13 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal |
| SMILES | C[C@]12CC=C[C@](CCC=O)(C(=O)O1)C2I |
| InChI | InChI=1S/C11H13IO3/c1-10-4-2-5-11(8(10)12,6-3-7-13)9(14)15-10/h2,5,7-8H,3-4,6H2,1H3/t8?,10-,11-/m1/s1 |
| InChIKey | IVOJZGXWRKKMBJ-GUJYYOPSSA-N |
| XLogP | 2.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal?
The IUPAC name of 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal (CID 12958419) is 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal.
What is the SMILES notation for 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal?
The canonical SMILES for 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal is C[C@]12CC=C[C@](CCC=O)(C(=O)O1)C2I.
What is the InChIKey of 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal?
The InChIKey is IVOJZGXWRKKMBJ-GUJYYOPSSA-N. The full InChI is InChI=1S/C11H13IO3/c1-10-4-2-5-11(8(10)12,6-3-7-13)9(14)15-10/h2,5,7-8H,3-4,6H2,1H3/t8?,10-,11-/m1/s1.
What are the key properties of 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal?
3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal has a molecular weight of 320.13 g/mol, XLogP of 2.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,5R)-8-iodo-5-methyl-7-oxo-6-oxabicyclo[3.2.1]oct-2-en-1-yl]propanal is sourced from PubChem (CID 12958419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).