C7H5ClN2O2S — CID 12958937
5-chloro-2-propa-1,2-dienylsulfonylpyrimidine (PubChem CID 12958937) has the molecular formula C7H5ClN2O2S and a molecular weight of 216.65 g/mol. Its IUPAC name is 5-chloro-2-propa-1,2-dienylsulfonylpyrimidine.
| Compound Name | 5-chloro-2-propa-1,2-dienylsulfonylpyrimidine |
|---|---|
| PubChem CID | 12958937 |
| Molecular Formula | C7H5ClN2O2S |
| Molecular Weight | 216.65 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 5-chloro-2-propa-1,2-dienylsulfonylpyrimidine |
| SMILES | C=C=CS(=O)(=O)c1ncc(Cl)cn1 |
| InChI | InChI=1S/C7H5ClN2O2S/c1-2-3-13(11,12)7-9-4-6(8)5-10-7/h3-5H,1H2 |
| InChIKey | FEXFFZBLHZLWDA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.65 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |