C11H13NO — CID 12959092
4-benzyl-3-methyl-4,5-dihydro-1,2-oxazole (PubChem CID 12959092) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 4-benzyl-3-methyl-4,5-dihydro-1,2-oxazole.
| Compound Name | 4-benzyl-3-methyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 12959092 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 4-benzyl-3-methyl-4,5-dihydro-1,2-oxazole |
| SMILES | CC1=NOCC1Cc1ccccc1 |
| InChI | InChI=1S/C11H13NO/c1-9-11(8-13-12-9)7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3 |
| InChIKey | UARNGKZRMTXHGR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |