C11H13FO3 — CID 12960810
methyl (2E,4E,6Z)-6-fluoro-3,7-dimethyl-8-oxoocta-2,4,6-trienoate (PubChem CID 12960810) has the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. Its IUPAC name is methyl (2E,4E,6Z)-6-fluoro-3,7-dimethyl-8-oxoocta-2,4,6-trienoate.
| Compound Name | methyl (2E,4E,6Z)-6-fluoro-3,7-dimethyl-8-oxoocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 12960810 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | methyl (2E,4E,6Z)-6-fluoro-3,7-dimethyl-8-oxoocta-2,4,6-trienoate |
| SMILES | COC(=O)/C=C(C)/C=C/C(F)=C(\C)C=O |
| InChI | InChI=1S/C11H13FO3/c1-8(6-11(14)15-3)4-5-10(12)9(2)7-13/h4-7H,1-3H3/b5-4+,8-6+,10-9- |
| InChIKey | OXADCEQZGBYOER-UDVXFSHZSA-N |
| XLogP | 2.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|