C23H34NO5P — CID 12962086
(2S,4R)-4-cyclohexyl-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 12962086) has the molecular formula C23H34NO5P and a molecular weight of 435.50 g/mol. Its IUPAC name is (2S,4R)-4-cyclohexyl-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-cyclohexyl-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 12962086 |
| Molecular Formula | C23H34NO5P |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | (2S,4R)-4-cyclohexyl-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](C2CCCCC2)CN1C(=O)CP(=O)(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C23H34NO5P/c25-22(17-30(28,29)14-8-7-11-18-9-3-1-4-10-18)24-16-20(15-21(24)23(26)27)19-12-5-2-6-13-19/h1,3-4,9-10,19-21H,2,5-8,11-17H2,(H,26,27)(H,28,29)/t20-,21-/m0/s1 |
| InChIKey | WOIWWYDXDVSWAZ-SFTDATJTSA-N |
| XLogP | 4.16 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|