C8H6N6O4 — CID 12962786
2-hydroxy-3-nitro-N-(2H-tetrazol-5-yl)benzamide (PubChem CID 12962786) has the molecular formula C8H6N6O4 and a molecular weight of 250.17 g/mol. Its IUPAC name is 2-hydroxy-3-nitro-N-(2H-tetrazol-5-yl)benzamide.
| Compound Name | 2-hydroxy-3-nitro-N-(2H-tetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 12962786 |
| Molecular Formula | C8H6N6O4 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-hydroxy-3-nitro-N-(2H-tetrazol-5-yl)benzamide |
| SMILES | O=C(Nc1nn[nH]n1)c1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H6N6O4/c15-6-4(2-1-3-5(6)14(17)18)7(16)9-8-10-12-13-11-8/h1-3,15H,(H2,9,10,11,12,13,16) |
| InChIKey | XZIYLVYRSWZLLM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 146.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|